C9H14N4 — CID 66490640
6,7,8,9-tetrahydro-5H-cyclohepta[d]pyrimidin-2-ylhydrazine (PubChem CID 66490640) has the molecular formula C9H14N4 and a molecular weight of 178.24 g/mol. Its IUPAC name is 6,7,8,9-tetrahydro-5H-cyclohepta[d]pyrimidin-2-ylhydrazine.
| Compound Name | 6,7,8,9-tetrahydro-5H-cyclohepta[d]pyrimidin-2-ylhydrazine |
|---|---|
| PubChem CID | 66490640 |
| Molecular Formula | C9H14N4 |
| Molecular Weight | 178.24 g/mol |
| Exact Mass | 178.12 |
| IUPAC Name | 6,7,8,9-tetrahydro-5H-cyclohepta[d]pyrimidin-2-ylhydrazine |
| SMILES | NNc1ncc2c(n1)CCCCC2 |
| InChI | InChI=1S/C9H14N4/c10-13-9-11-6-7-4-2-1-3-5-8(7)12-9/h6H,1-5,10H2,(H,11,12,13) |
| InChIKey | WWASPDAHXOKAOM-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.24 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|