C19H16ClF3N6O — CID 170919764
3-[[1-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]piperidin-4-yl]diazenyl]-1H-quinoxalin-2-one (PubChem CID 170919764) has the molecular formula C19H16ClF3N6O and a molecular weight of 436.83 g/mol. Its IUPAC name is 3-[[1-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]piperidin-4-yl]diazenyl]-1H-quinoxalin-2-one.
| Compound Name | 3-[[1-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]piperidin-4-yl]diazenyl]-1H-quinoxalin-2-one |
|---|---|
| PubChem CID | 170919764 |
| Molecular Formula | C19H16ClF3N6O |
| Molecular Weight | 436.83 g/mol |
| Exact Mass | 436.10 |
| IUPAC Name | 3-[[1-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]piperidin-4-yl]diazenyl]-1H-quinoxalin-2-one |
| SMILES | O=c1[nH]c2ccccc2nc1/N=N/C1CCN(c2ncc(C(F)(F)F)cc2Cl)CC1 |
| InChI | InChI=1S/C19H16ClF3N6O/c20-13-9-11(19(21,22)23)10-24-17(13)29-7-5-12(6-8-29)27-28-16-18(30)26-15-4-2-1-3-14(15)25-16/h1-4,9-10,12H,5-8H2,(H,26,30)/b28-27+ |
| InChIKey | PSWZKISLTYILDH-BYYHNAKLSA-N |
| XLogP | 4.74 |
| TPSA | 86.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.83 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|