C45H72N15O20Se — CID 170923227
CID 170923227 (PubChem CID 170923227) has the molecular formula C45H72N15O20Se and a molecular weight of 1222.12 g/mol.
| Compound Name | CID 170923227 |
|---|---|
| PubChem CID | 170923227 |
| Molecular Formula | C45H72N15O20Se |
| Molecular Weight | 1222.12 g/mol |
| Exact Mass | 1222.42 |
| IUPAC Name | — |
| SMILES | CC[C@H](C)[C@H](NC(=O)[C@H](CC(N)=O)NC(=O)[C@H](CC(N)=O)NC(=O)[C@H](CCC(=O)O)NC(=O)[C@H](CO)NC(=O)[C@H](CCCN=C(N)N)NC(=O)[C@H](C[Se])NC(=O)[C@@H]1CCCN1)C(=O)N[C@@H](CC(=O)O)C(=O)N[C@@H](CCC(=O)O)C(=O)O |
| InChI | InChI=1S/C45H72N15O20Se/c1-3-19(2)34(43(78)57-26(16-33(68)69)39(74)54-23(44(79)80)9-11-32(66)67)60-40(75)25(15-30(47)63)56-38(73)24(14-29(46)62)55-37(72)22(8-10-31(64)65)53-41(76)27(17-61)58-36(71)21(7-5-13-51-45(48)49)52-42(77)28(18-81)59-35(70)20-6-4-12-50-20/h19-28,34,50,61H,3-18H2,1-2H3,(H2,46,62)(H2,47,63)(H,52,77)(H,53,76)(H,54,74)(H,55,72)(H,56,73)(H,57,78)(H,58,71)(H,59,70)(H,60,75)(H,64,65)(H,66,67)(H,68,69)(H,79,80)(H4,48,49,51)/t19-,20-,21-,22-,23-,24-,25-,26-,27-,28-,34-/m0/s1 |
| InChIKey | PEDQUKHVLNSFGQ-JCJPVWQYSA-N |
| XLogP | -9.18 |
| TPSA | 593.94 Ų |
| H-Bond Donors | 19 |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 39 |
| Heavy Atoms | 81 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1222.12 |
| LogP ≤ 5 | -9.18 |
| H-Bond Donors ≤ 5 | 19 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|