C14H18BrNO3 — CID 170923431
[(3S)-3-(4-bromophenyl)-4,4-dimethyl-1-oxopentan-2-yl]carbamic acid (PubChem CID 170923431) has the molecular formula C14H18BrNO3 and a molecular weight of 328.21 g/mol. Its IUPAC name is [(3S)-3-(4-bromophenyl)-4,4-dimethyl-1-oxopentan-2-yl]carbamic acid.
| Compound Name | [(3S)-3-(4-bromophenyl)-4,4-dimethyl-1-oxopentan-2-yl]carbamic acid |
|---|---|
| PubChem CID | 170923431 |
| Molecular Formula | C14H18BrNO3 |
| Molecular Weight | 328.21 g/mol |
| Exact Mass | 327.05 |
| IUPAC Name | [(3S)-3-(4-bromophenyl)-4,4-dimethyl-1-oxopentan-2-yl]carbamic acid |
| SMILES | CC(C)(C)[C@@H](c1ccc(Br)cc1)C(C=O)NC(=O)O |
| InChI | InChI=1S/C14H18BrNO3/c1-14(2,3)12(11(8-17)16-13(18)19)9-4-6-10(15)7-5-9/h4-8,11-12,16H,1-3H3,(H,18,19)/t11?,12-/m0/s1 |
| InChIKey | GJKDGFZRYFWOCC-KIYNQFGBSA-N |
| XLogP | 3.41 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.21 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|