C27H31F2N5O2 — CID 170925726
tert-butyl (5R)-6-[3-cyano-4-(2,4-difluorophenyl)-5,6,7,8-tetrahydro-1,7-naphthyridin-2-yl]-5-methyl-2,6-diazaspiro[3.4]octane-2-carboxylate (PubChem CID 170925726) has the molecular formula C27H31F2N5O2 and a molecular weight of 495.57 g/mol. Its IUPAC name is tert-butyl (5R)-6-[3-cyano-4-(2,4-difluorophenyl)-5,6,7,8-tetrahydro-1,7-naphthyridin-2-yl]-5-methyl-2,6-diazaspiro[3.4]octane-2-carboxylate.
| Compound Name | tert-butyl (5R)-6-[3-cyano-4-(2,4-difluorophenyl)-5,6,7,8-tetrahydro-1,7-naphthyridin-2-yl]-5-methyl-2,6-diazaspiro[3.4]octane-2-carboxylate |
|---|---|
| PubChem CID | 170925726 |
| Molecular Formula | C27H31F2N5O2 |
| Molecular Weight | 495.57 g/mol |
| Exact Mass | 495.24 |
| IUPAC Name | tert-butyl (5R)-6-[3-cyano-4-(2,4-difluorophenyl)-5,6,7,8-tetrahydro-1,7-naphthyridin-2-yl]-5-methyl-2,6-diazaspiro[3.4]octane-2-carboxylate |
| SMILES | C[C@H]1N(c2nc3c(c(-c4ccc(F)cc4F)c2C#N)CCNC3)CCC12CN(C(=O)OC(C)(C)C)C2 |
| InChI | InChI=1S/C27H31F2N5O2/c1-16-27(14-33(15-27)25(35)36-26(2,3)4)8-10-34(16)24-20(12-30)23(18-6-5-17(28)11-21(18)29)19-7-9-31-13-22(19)32-24/h5-6,11,16,31H,7-10,13-15H2,1-4H3/t16-/m1/s1 |
| InChIKey | QNBVUBMOLINGKC-MRXNPFEDSA-N |
| XLogP | 4.38 |
| TPSA | 81.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.57 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |