C16H31NO3 — CID 170927509
tert-butyl N-[(2R)-3,3-dimethyl-1-pent-4-enoxybutan-2-yl]carbamate (PubChem CID 170927509) has the molecular formula C16H31NO3 and a molecular weight of 285.43 g/mol. Its IUPAC name is tert-butyl N-[(2R)-3,3-dimethyl-1-pent-4-enoxybutan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2R)-3,3-dimethyl-1-pent-4-enoxybutan-2-yl]carbamate |
|---|---|
| PubChem CID | 170927509 |
| Molecular Formula | C16H31NO3 |
| Molecular Weight | 285.43 g/mol |
| Exact Mass | 285.23 |
| IUPAC Name | tert-butyl N-[(2R)-3,3-dimethyl-1-pent-4-enoxybutan-2-yl]carbamate |
| SMILES | C=CCCCOC[C@H](NC(=O)OC(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C16H31NO3/c1-8-9-10-11-19-12-13(15(2,3)4)17-14(18)20-16(5,6)7/h8,13H,1,9-12H2,2-7H3,(H,17,18)/t13-/m0/s1 |
| InChIKey | HHWLNYFAOQLQCQ-ZDUSSCGKSA-N |
| XLogP | 3.91 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.43 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|