C11H19NO4 — CID 89280637
[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]pent-4-enyl] formate (PubChem CID 89280637) has the molecular formula C11H19NO4 and a molecular weight of 229.28 g/mol. Its IUPAC name is [(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]pent-4-enyl] formate.
| Compound Name | [(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]pent-4-enyl] formate |
|---|---|
| PubChem CID | 89280637 |
| Molecular Formula | C11H19NO4 |
| Molecular Weight | 229.28 g/mol |
| Exact Mass | 229.13 |
| IUPAC Name | [(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]pent-4-enyl] formate |
| SMILES | C=CC[C@@H](COC=O)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C11H19NO4/c1-5-6-9(7-15-8-13)12-10(14)16-11(2,3)4/h5,8-9H,1,6-7H2,2-4H3,(H,12,14)/t9-/m0/s1 |
| InChIKey | YDSWYLQEWVCLLZ-VIFPVBQESA-N |
| XLogP | 1.63 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.28 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|