C16H16N2O6 — CID 170927559
(3S)-3-[(3R)-3-(hydroxymethyl)-6-oxo-3,8-dihydro-2H-[1,4]dioxino[2,3-f]isoindol-7-yl]piperidine-2,6-dione (PubChem CID 170927559) has the molecular formula C16H16N2O6 and a molecular weight of 332.31 g/mol. Its IUPAC name is (3S)-3-[(3R)-3-(hydroxymethyl)-6-oxo-3,8-dihydro-2H-[1,4]dioxino[2,3-f]isoindol-7-yl]piperidine-2,6-dione.
| Compound Name | (3S)-3-[(3R)-3-(hydroxymethyl)-6-oxo-3,8-dihydro-2H-[1,4]dioxino[2,3-f]isoindol-7-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 170927559 |
| Molecular Formula | C16H16N2O6 |
| Molecular Weight | 332.31 g/mol |
| Exact Mass | 332.10 |
| IUPAC Name | (3S)-3-[(3R)-3-(hydroxymethyl)-6-oxo-3,8-dihydro-2H-[1,4]dioxino[2,3-f]isoindol-7-yl]piperidine-2,6-dione |
| SMILES | C1CC(=O)NC(=O)[C@H]1N2CC3=CC4=C(C=C3C2=O)O[C@@H](CO4)CO |
| InChI | InChI=1S/C16H16N2O6/c19-6-9-7-23-12-3-8-5-18(11-1-2-14(20)17-15(11)21)16(22)10(8)4-13(12)24-9/h3-4,9,11,19H,1-2,5-7H2,(H,17,20,21)/t9-,11+/m1/s1 |
| InChIKey | WJYQZAMMQVPGII-KOLCDFICSA-N |
| XLogP | -0.70 |
| TPSA | 105.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | 567 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.31 |
| LogP ≤ 5 | -0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|