C16H17N3O5 — CID 170927595
(3S)-3-[(2S)-2-(hydroxymethyl)-7-oxo-2,3,4,9-tetrahydropyrrolo[3,4-h][1,4]benzoxazin-8-yl]piperidine-2,6-dione (PubChem CID 170927595) has the molecular formula C16H17N3O5 and a molecular weight of 331.33 g/mol. Its IUPAC name is (3S)-3-[(2S)-2-(hydroxymethyl)-7-oxo-2,3,4,9-tetrahydropyrrolo[3,4-h][1,4]benzoxazin-8-yl]piperidine-2,6-dione.
| Compound Name | (3S)-3-[(2S)-2-(hydroxymethyl)-7-oxo-2,3,4,9-tetrahydropyrrolo[3,4-h][1,4]benzoxazin-8-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 170927595 |
| Molecular Formula | C16H17N3O5 |
| Molecular Weight | 331.33 g/mol |
| Exact Mass | 331.12 |
| IUPAC Name | (3S)-3-[(2S)-2-(hydroxymethyl)-7-oxo-2,3,4,9-tetrahydropyrrolo[3,4-h][1,4]benzoxazin-8-yl]piperidine-2,6-dione |
| SMILES | O=C1CC[C@H](N2Cc3c(ccc4c3O[C@H](CO)CN4)C2=O)C(=O)N1 |
| InChI | InChI=1S/C16H17N3O5/c20-7-8-5-17-11-2-1-9-10(14(11)24-8)6-19(16(9)23)12-3-4-13(21)18-15(12)22/h1-2,8,12,17,20H,3-7H2,(H,18,21,22)/t8-,12-/m0/s1 |
| InChIKey | KEEUORPARLNTHC-UFBFGSQYSA-N |
| XLogP | -0.39 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.33 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|