C15H24 — CID 170931178
1,3,5-tris(1,1,2,2-tetradeuteriopropyl)benzene (PubChem CID 170931178) has the molecular formula C15H24 and a molecular weight of 216.43 g/mol. Its IUPAC name is 1,3,5-tris(1,1,2,2-tetradeuteriopropyl)benzene.
| Compound Name | 1,3,5-tris(1,1,2,2-tetradeuteriopropyl)benzene |
|---|---|
| PubChem CID | 170931178 |
| Molecular Formula | C15H24 |
| Molecular Weight | 216.43 g/mol |
| Exact Mass | 216.26 |
| IUPAC Name | 1,3,5-tris(1,1,2,2-tetradeuteriopropyl)benzene |
| SMILES | [2H]C([2H])(C)C([2H])([2H])c1cc(C([2H])([2H])C([2H])([2H])C)cc(C([2H])([2H])C([2H])([2H])C)c1 |
| InChI | InChI=1S/C15H24/c1-4-7-13-10-14(8-5-2)12-15(11-13)9-6-3/h10-12H,4-9H2,1-3H3/i4D2,5D2,6D2,7D2,8D2,9D2 |
| InChIKey | MSUBBMNPXKLJEW-YSGWUIRQSA-N |
| XLogP | 4.54 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.43 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |