C13H8F3N3 — CID 170936103
5,6-difluoro-3-(5-fluoropyrimidin-4-yl)-1-methylindole (PubChem CID 170936103) has the molecular formula C13H8F3N3 and a molecular weight of 263.22 g/mol. Its IUPAC name is 5,6-difluoro-3-(5-fluoropyrimidin-4-yl)-1-methylindole.
| Compound Name | 5,6-difluoro-3-(5-fluoropyrimidin-4-yl)-1-methylindole |
|---|---|
| PubChem CID | 170936103 |
| Molecular Formula | C13H8F3N3 |
| Molecular Weight | 263.22 g/mol |
| Exact Mass | 263.07 |
| IUPAC Name | 5,6-difluoro-3-(5-fluoropyrimidin-4-yl)-1-methylindole |
| SMILES | Cn1cc(-c2ncncc2F)c2cc(F)c(F)cc21 |
| InChI | InChI=1S/C13H8F3N3/c1-19-5-8(13-11(16)4-17-6-18-13)7-2-9(14)10(15)3-12(7)19/h2-6H,1H3 |
| InChIKey | HRKMVARZBUBSPP-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.22 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |