C18H22N6O14P3- — CID 170936903
[(2R,3R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-3-[2-(1-azidoethyl)benzoyl]oxyoxolan-2-yl]methyl [hydroxy(phosphonooxy)phosphoryl] phosphate (PubChem CID 170936903) has the molecular formula C18H22N6O14P3- and a molecular weight of 639.32 g/mol. Its IUPAC name is [(2R,3R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-3-[2-(1-azidoethyl)benzoyl]oxyoxolan-2-yl]methyl [hydroxy(phosphonooxy)phosphoryl] phosphate.
| Compound Name | [(2R,3R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-3-[2-(1-azidoethyl)benzoyl]oxyoxolan-2-yl]methyl [hydroxy(phosphonooxy)phosphoryl] phosphate |
|---|---|
| PubChem CID | 170936903 |
| Molecular Formula | C18H22N6O14P3- |
| Molecular Weight | 639.32 g/mol |
| Exact Mass | 639.04 |
| IUPAC Name | [(2R,3R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-3-[2-(1-azidoethyl)benzoyl]oxyoxolan-2-yl]methyl [hydroxy(phosphonooxy)phosphoryl] phosphate |
| SMILES | CC(N=[N+]=[N-])c1ccccc1C(=O)O[C@@H]1C[C@H](n2ccc(N)nc2=O)O[C@@H]1COP(=O)([O-])OP(=O)(O)OP(=O)(O)O |
| InChI | InChI=1S/C18H23N6O14P3/c1-10(22-23-20)11-4-2-3-5-12(11)17(25)36-13-8-16(24-7-6-15(19)21-18(24)26)35-14(13)9-34-40(30,31)38-41(32,33)37-39(27,28)29/h2-7,10,13-14,16H,8-9H2,1H3,(H,30,31)(H,32,33)(H2,19,21,26)(H2,27,28,29)/p-1/t10?,13-,14-,16-/m1/s1 |
| InChIKey | FGCHFZXDHPDYAV-GLUFUESFSA-M |
| XLogP | 1.42 |
| TPSA | 307.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.32 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|