C18H19ClN4OS — CID 170947961
1-[(4-chloro-2-piperidin-2-ylphenyl)methyl]-2-sulfanylidene-5H-pyrrolo[3,2-d]pyrimidin-4-one (PubChem CID 170947961) has the molecular formula C18H19ClN4OS and a molecular weight of 374.90 g/mol. Its IUPAC name is 1-[(4-chloro-2-piperidin-2-ylphenyl)methyl]-2-sulfanylidene-5H-pyrrolo[3,2-d]pyrimidin-4-one.
| Compound Name | 1-[(4-chloro-2-piperidin-2-ylphenyl)methyl]-2-sulfanylidene-5H-pyrrolo[3,2-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 170947961 |
| Molecular Formula | C18H19ClN4OS |
| Molecular Weight | 374.90 g/mol |
| Exact Mass | 374.10 |
| IUPAC Name | 1-[(4-chloro-2-piperidin-2-ylphenyl)methyl]-2-sulfanylidene-5H-pyrrolo[3,2-d]pyrimidin-4-one |
| SMILES | O=c1[nH]c(=S)n(Cc2ccc(Cl)cc2C2CCCCN2)c2cc[nH]c12 |
| InChI | InChI=1S/C18H19ClN4OS/c19-12-5-4-11(13(9-12)14-3-1-2-7-20-14)10-23-15-6-8-21-16(15)17(24)22-18(23)25/h4-6,8-9,14,20-21H,1-3,7,10H2,(H,22,24,25) |
| InChIKey | HYMMJFXNYSKPGT-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 65.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.90 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|