C18H17ClN4O4S — CID 174234956
3-[5-chloro-2-[(4-oxo-2-sulfanylidene-5H-pyrrolo[3,2-d]pyrimidin-1-yl)methyl]phenyl]morpholine-4-carboxylic acid (PubChem CID 174234956) has the molecular formula C18H17ClN4O4S and a molecular weight of 420.88 g/mol. Its IUPAC name is 3-[5-chloro-2-[(4-oxo-2-sulfanylidene-5H-pyrrolo[3,2-d]pyrimidin-1-yl)methyl]phenyl]morpholine-4-carboxylic acid.
| Compound Name | 3-[5-chloro-2-[(4-oxo-2-sulfanylidene-5H-pyrrolo[3,2-d]pyrimidin-1-yl)methyl]phenyl]morpholine-4-carboxylic acid |
|---|---|
| PubChem CID | 174234956 |
| Molecular Formula | C18H17ClN4O4S |
| Molecular Weight | 420.88 g/mol |
| Exact Mass | 420.07 |
| IUPAC Name | 3-[5-chloro-2-[(4-oxo-2-sulfanylidene-5H-pyrrolo[3,2-d]pyrimidin-1-yl)methyl]phenyl]morpholine-4-carboxylic acid |
| SMILES | O=C(O)N1CCOCC1c1cc(Cl)ccc1Cn1c(=S)[nH]c(=O)c2[nH]ccc21 |
| InChI | InChI=1S/C18H17ClN4O4S/c19-11-2-1-10(12(7-11)14-9-27-6-5-22(14)18(25)26)8-23-13-3-4-20-15(13)16(24)21-17(23)28/h1-4,7,14,20H,5-6,8-9H2,(H,25,26)(H,21,24,28) |
| InChIKey | OSLSUQQZGONXSL-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 103.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.88 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|