C12H13F3N4O4S — CID 175343214
[3-(4-oxo-2-sulfanylidene-5H-pyrrolo[3,2-d]pyrimidin-1-yl)-2-(2,2,2-trifluoroethoxy)propyl] carbamate (PubChem CID 175343214) has the molecular formula C12H13F3N4O4S and a molecular weight of 366.32 g/mol. Its IUPAC name is [3-(4-oxo-2-sulfanylidene-5H-pyrrolo[3,2-d]pyrimidin-1-yl)-2-(2,2,2-trifluoroethoxy)propyl] carbamate.
| Compound Name | [3-(4-oxo-2-sulfanylidene-5H-pyrrolo[3,2-d]pyrimidin-1-yl)-2-(2,2,2-trifluoroethoxy)propyl] carbamate |
|---|---|
| PubChem CID | 175343214 |
| Molecular Formula | C12H13F3N4O4S |
| Molecular Weight | 366.32 g/mol |
| Exact Mass | 366.06 |
| IUPAC Name | [3-(4-oxo-2-sulfanylidene-5H-pyrrolo[3,2-d]pyrimidin-1-yl)-2-(2,2,2-trifluoroethoxy)propyl] carbamate |
| SMILES | NC(=O)OCC(Cn1c(=S)[nH]c(=O)c2[nH]ccc21)OCC(F)(F)F |
| InChI | InChI=1S/C12H13F3N4O4S/c13-12(14,15)5-23-6(4-22-10(16)21)3-19-7-1-2-17-8(7)9(20)18-11(19)24/h1-2,6,17H,3-5H2,(H2,16,21)(H,18,20,24) |
| InChIKey | SBPJLGBUUOMLNC-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 115.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.32 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|