C18H19ClN4OS — CID 175343204
1-[[4-chloro-2-(1-methylpyrrolidin-2-yl)phenyl]methyl]-2-sulfanylidene-5H-pyrrolo[3,2-d]pyrimidin-4-one (PubChem CID 175343204) has the molecular formula C18H19ClN4OS and a molecular weight of 374.90 g/mol. Its IUPAC name is 1-[[4-chloro-2-(1-methylpyrrolidin-2-yl)phenyl]methyl]-2-sulfanylidene-5H-pyrrolo[3,2-d]pyrimidin-4-one.
| Compound Name | 1-[[4-chloro-2-(1-methylpyrrolidin-2-yl)phenyl]methyl]-2-sulfanylidene-5H-pyrrolo[3,2-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 175343204 |
| Molecular Formula | C18H19ClN4OS |
| Molecular Weight | 374.90 g/mol |
| Exact Mass | 374.10 |
| IUPAC Name | 1-[[4-chloro-2-(1-methylpyrrolidin-2-yl)phenyl]methyl]-2-sulfanylidene-5H-pyrrolo[3,2-d]pyrimidin-4-one |
| SMILES | CN1CCCC1c1cc(Cl)ccc1Cn1c(=S)[nH]c(=O)c2[nH]ccc21 |
| InChI | InChI=1S/C18H19ClN4OS/c1-22-8-2-3-14(22)13-9-12(19)5-4-11(13)10-23-15-6-7-20-16(15)17(24)21-18(23)25/h4-7,9,14,20H,2-3,8,10H2,1H3,(H,21,24,25) |
| InChIKey | UDNKURXPXYQXHT-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 56.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.90 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|