C18H19N5O4S — CID 170949696
methyl 2-[4-[(3-cyano-4-methyl-1H-indol-7-yl)sulfamoyl]-2-ethylimidazol-1-yl]acetate (PubChem CID 170949696) has the molecular formula C18H19N5O4S and a molecular weight of 401.45 g/mol. Its IUPAC name is methyl 2-[4-[(3-cyano-4-methyl-1H-indol-7-yl)sulfamoyl]-2-ethylimidazol-1-yl]acetate.
| Compound Name | methyl 2-[4-[(3-cyano-4-methyl-1H-indol-7-yl)sulfamoyl]-2-ethylimidazol-1-yl]acetate |
|---|---|
| PubChem CID | 170949696 |
| Molecular Formula | C18H19N5O4S |
| Molecular Weight | 401.45 g/mol |
| Exact Mass | 401.12 |
| IUPAC Name | methyl 2-[4-[(3-cyano-4-methyl-1H-indol-7-yl)sulfamoyl]-2-ethylimidazol-1-yl]acetate |
| SMILES | CCc1nc(S(=O)(=O)Nc2ccc(C)c3c(C#N)c[nH]c23)cn1CC(=O)OC |
| InChI | InChI=1S/C18H19N5O4S/c1-4-14-21-15(9-23(14)10-16(24)27-3)28(25,26)22-13-6-5-11(2)17-12(7-19)8-20-18(13)17/h5-6,8-9,20,22H,4,10H2,1-3H3 |
| InChIKey | ZRBJDPWNMGZXSP-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 129.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.45 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |