C12H17FN2OS — CID 170950881
2-[[(3S)-1-(3-fluoropropyl)pyrrolidin-3-yl]methyl]-1,3-thiazole-5-carbaldehyde (PubChem CID 170950881) has the molecular formula C12H17FN2OS and a molecular weight of 256.35 g/mol. Its IUPAC name is 2-[[(3S)-1-(3-fluoropropyl)pyrrolidin-3-yl]methyl]-1,3-thiazole-5-carbaldehyde.
| Compound Name | 2-[[(3S)-1-(3-fluoropropyl)pyrrolidin-3-yl]methyl]-1,3-thiazole-5-carbaldehyde |
|---|---|
| PubChem CID | 170950881 |
| Molecular Formula | C12H17FN2OS |
| Molecular Weight | 256.35 g/mol |
| Exact Mass | 256.10 |
| IUPAC Name | 2-[[(3S)-1-(3-fluoropropyl)pyrrolidin-3-yl]methyl]-1,3-thiazole-5-carbaldehyde |
| SMILES | O=Cc1cnc(C[C@@H]2CCN(CCCF)C2)s1 |
| InChI | InChI=1S/C12H17FN2OS/c13-3-1-4-15-5-2-10(8-15)6-12-14-7-11(9-16)17-12/h7,9-10H,1-6,8H2/t10-/m0/s1 |
| InChIKey | GTCUBASOWKVRBA-JTQLQIEISA-N |
| XLogP | 2.18 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.35 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|