C10H11F2NOS — CID 123941630
2-(4,4-difluorocyclohexyl)-1,3-thiazole-5-carbaldehyde (PubChem CID 123941630) has the molecular formula C10H11F2NOS and a molecular weight of 231.27 g/mol. Its IUPAC name is 2-(4,4-difluorocyclohexyl)-1,3-thiazole-5-carbaldehyde.
| Compound Name | 2-(4,4-difluorocyclohexyl)-1,3-thiazole-5-carbaldehyde |
|---|---|
| PubChem CID | 123941630 |
| Molecular Formula | C10H11F2NOS |
| Molecular Weight | 231.27 g/mol |
| Exact Mass | 231.05 |
| IUPAC Name | 2-(4,4-difluorocyclohexyl)-1,3-thiazole-5-carbaldehyde |
| SMILES | O=Cc1cnc(C2CCC(F)(F)CC2)s1 |
| InChI | InChI=1S/C10H11F2NOS/c11-10(12)3-1-7(2-4-10)9-13-5-8(6-14)15-9/h5-7H,1-4H2 |
| InChIKey | YHOIDEJLUJURBG-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.27 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|