C12H16F2N2OS — CID 170950946
2-[[(3S)-1-(3,3-difluoropropyl)pyrrolidin-3-yl]methyl]-1,3-thiazole-5-carbaldehyde (PubChem CID 170950946) has the molecular formula C12H16F2N2OS and a molecular weight of 274.34 g/mol. Its IUPAC name is 2-[[(3S)-1-(3,3-difluoropropyl)pyrrolidin-3-yl]methyl]-1,3-thiazole-5-carbaldehyde.
| Compound Name | 2-[[(3S)-1-(3,3-difluoropropyl)pyrrolidin-3-yl]methyl]-1,3-thiazole-5-carbaldehyde |
|---|---|
| PubChem CID | 170950946 |
| Molecular Formula | C12H16F2N2OS |
| Molecular Weight | 274.34 g/mol |
| Exact Mass | 274.10 |
| IUPAC Name | 2-[[(3S)-1-(3,3-difluoropropyl)pyrrolidin-3-yl]methyl]-1,3-thiazole-5-carbaldehyde |
| SMILES | O=Cc1cnc(C[C@@H]2CCN(CCC(F)F)C2)s1 |
| InChI | InChI=1S/C12H16F2N2OS/c13-11(14)2-4-16-3-1-9(7-16)5-12-15-6-10(8-17)18-12/h6,8-9,11H,1-5,7H2/t9-/m0/s1 |
| InChIKey | XMAHXXMUXWSLFS-VIFPVBQESA-N |
| XLogP | 2.48 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.34 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|