C30H30N4O3 — CID 170951287
N-[[4-(dimethylamino)phenyl]methyl]-3-[2-hydroxy-1-[(4-pyridin-4-ylbenzoyl)amino]ethyl]benzamide (PubChem CID 170951287) has the molecular formula C30H30N4O3 and a molecular weight of 494.60 g/mol. Its IUPAC name is N-[[4-(dimethylamino)phenyl]methyl]-3-[2-hydroxy-1-[(4-pyridin-4-ylbenzoyl)amino]ethyl]benzamide.
| Compound Name | N-[[4-(dimethylamino)phenyl]methyl]-3-[2-hydroxy-1-[(4-pyridin-4-ylbenzoyl)amino]ethyl]benzamide |
|---|---|
| PubChem CID | 170951287 |
| Molecular Formula | C30H30N4O3 |
| Molecular Weight | 494.60 g/mol |
| Exact Mass | 494.23 |
| IUPAC Name | N-[[4-(dimethylamino)phenyl]methyl]-3-[2-hydroxy-1-[(4-pyridin-4-ylbenzoyl)amino]ethyl]benzamide |
| SMILES | CN(C)c1ccc(CNC(=O)c2cccc(C(CO)NC(=O)c3ccc(-c4ccncc4)cc3)c2)cc1 |
| InChI | InChI=1S/C30H30N4O3/c1-34(2)27-12-6-21(7-13-27)19-32-29(36)26-5-3-4-25(18-26)28(20-35)33-30(37)24-10-8-22(9-11-24)23-14-16-31-17-15-23/h3-18,28,35H,19-20H2,1-2H3,(H,32,36)(H,33,37) |
| InChIKey | ZVFHUTAILOUYLO-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 94.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.60 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|