C26H32ClN5O2 — CID 170955910
N-[1-[4-(2-chlorophenyl)phenyl]ethyl]-1-[2-[[(2Z)-2-hydrazinylideneethylidene]amino]-3-methylbutanoyl]pyrrolidine-2-carboxamide (PubChem CID 170955910) has the molecular formula C26H32ClN5O2 and a molecular weight of 482.03 g/mol. Its IUPAC name is N-[1-[4-(2-chlorophenyl)phenyl]ethyl]-1-[2-[[(2Z)-2-hydrazinylideneethylidene]amino]-3-methylbutanoyl]pyrrolidine-2-carboxamide.
| Compound Name | N-[1-[4-(2-chlorophenyl)phenyl]ethyl]-1-[2-[[(2Z)-2-hydrazinylideneethylidene]amino]-3-methylbutanoyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 170955910 |
| Molecular Formula | C26H32ClN5O2 |
| Molecular Weight | 482.03 g/mol |
| Exact Mass | 481.22 |
| IUPAC Name | N-[1-[4-(2-chlorophenyl)phenyl]ethyl]-1-[2-[[(2Z)-2-hydrazinylideneethylidene]amino]-3-methylbutanoyl]pyrrolidine-2-carboxamide |
| SMILES | CC(NC(=O)C1CCCN1C(=O)C(/N=C/C=N\N)C(C)C)c1ccc(-c2ccccc2Cl)cc1 |
| InChI | InChI=1S/C26H32ClN5O2/c1-17(2)24(29-14-15-30-28)26(34)32-16-6-9-23(32)25(33)31-18(3)19-10-12-20(13-11-19)21-7-4-5-8-22(21)27/h4-5,7-8,10-15,17-18,23-24H,6,9,16,28H2,1-3H3,(H,31,33)/b29-14+,30-15- |
| InChIKey | XFYHISPDRPVHTA-HSXKGJOSSA-N |
| XLogP | 4.22 |
| TPSA | 100.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.03 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|