C26H39N7O2 — CID 170954618
N-[1-[4-[(1Z,3Z)-1,4-diamino-2-methylbuta-1,3-dienyl]phenyl]ethyl]-1-[2-[[(2Z)-2-hydrazinylidenepropylidene]amino]-3-methylbutanoyl]pyrrolidine-2-carboxamide (PubChem CID 170954618) has the molecular formula C26H39N7O2 and a molecular weight of 481.65 g/mol. Its IUPAC name is N-[1-[4-[(1Z,3Z)-1,4-diamino-2-methylbuta-1,3-dienyl]phenyl]ethyl]-1-[2-[[(2Z)-2-hydrazinylidenepropylidene]amino]-3-methylbutanoyl]pyrrolidine-2-carboxamide.
| Compound Name | N-[1-[4-[(1Z,3Z)-1,4-diamino-2-methylbuta-1,3-dienyl]phenyl]ethyl]-1-[2-[[(2Z)-2-hydrazinylidenepropylidene]amino]-3-methylbutanoyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 170954618 |
| Molecular Formula | C26H39N7O2 |
| Molecular Weight | 481.65 g/mol |
| Exact Mass | 481.32 |
| IUPAC Name | N-[1-[4-[(1Z,3Z)-1,4-diamino-2-methylbuta-1,3-dienyl]phenyl]ethyl]-1-[2-[[(2Z)-2-hydrazinylidenepropylidene]amino]-3-methylbutanoyl]pyrrolidine-2-carboxamide |
| SMILES | CC(/C=N/C(C(=O)N1CCCC1C(=O)NC(C)c1ccc(/C(N)=C(C)/C=C\N)cc1)C(C)C)=N/N |
| InChI | InChI=1S/C26H39N7O2/c1-16(2)24(30-15-18(4)32-29)26(35)33-14-6-7-22(33)25(34)31-19(5)20-8-10-21(11-9-20)23(28)17(3)12-13-27/h8-13,15-16,19,22,24H,6-7,14,27-29H2,1-5H3,(H,31,34)/b13-12-,23-17-,30-15+,32-18- |
| InChIKey | DDVITPZLZWFUSV-SUJCZWERSA-N |
| XLogP | 2.45 |
| TPSA | 152.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.65 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|