C26H39N7O3 — CID 174309698
(2S)-N-[(1R)-1-[4-[(1Z,3Z)-1,4-diamino-2-methylbuta-1,3-dienyl]phenyl]-2-hydroxyethyl]-1-[(2S)-2-(2-hydrazinylidenepropylideneamino)-3-methylbutanoyl]pyrrolidine-2-carboxamide (PubChem CID 174309698) has the molecular formula C26H39N7O3 and a molecular weight of 497.64 g/mol. Its IUPAC name is (2S)-N-[(1R)-1-[4-[(1Z,3Z)-1,4-diamino-2-methylbuta-1,3-dienyl]phenyl]-2-hydroxyethyl]-1-[(2S)-2-(2-hydrazinylidenepropylideneamino)-3-methylbutanoyl]pyrrolidine-2-carboxamide.
| Compound Name | (2S)-N-[(1R)-1-[4-[(1Z,3Z)-1,4-diamino-2-methylbuta-1,3-dienyl]phenyl]-2-hydroxyethyl]-1-[(2S)-2-(2-hydrazinylidenepropylideneamino)-3-methylbutanoyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 174309698 |
| Molecular Formula | C26H39N7O3 |
| Molecular Weight | 497.64 g/mol |
| Exact Mass | 497.31 |
| IUPAC Name | (2S)-N-[(1R)-1-[4-[(1Z,3Z)-1,4-diamino-2-methylbuta-1,3-dienyl]phenyl]-2-hydroxyethyl]-1-[(2S)-2-(2-hydrazinylidenepropylideneamino)-3-methylbutanoyl]pyrrolidine-2-carboxamide |
| SMILES | CC(/C=N/[C@H](C(=O)N1CCC[C@H]1C(=O)N[C@@H](CO)c1ccc(/C(N)=C(C)/C=C\N)cc1)C(C)C)=NN |
| InChI | InChI=1S/C26H39N7O3/c1-16(2)24(30-14-18(4)32-29)26(36)33-13-5-6-22(33)25(35)31-21(15-34)19-7-9-20(10-8-19)23(28)17(3)11-12-27/h7-12,14,16,21-22,24,34H,5-6,13,15,27-29H2,1-4H3,(H,31,35)/b12-11-,23-17-,30-14+,32-18?/t21-,22-,24-/m0/s1 |
| InChIKey | WTNDDZHYUNYMRO-OKXJBCBOSA-N |
| XLogP | 1.42 |
| TPSA | 172.42 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.64 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|