C24H34N8O2 — CID 170954629
(2S)-1-[(2S)-2-[[(2Z)-2-hydrazinylidenepropylidene]amino]-3-methylbutanoyl]-N-[(1S)-1-[4-(1,3,5-triazin-2-yl)cyclohexa-1,5-dien-1-yl]ethyl]pyrrolidine-2-carboxamide (PubChem CID 170954629) has the molecular formula C24H34N8O2 and a molecular weight of 466.59 g/mol. Its IUPAC name is (2S)-1-[(2S)-2-[[(2Z)-2-hydrazinylidenepropylidene]amino]-3-methylbutanoyl]-N-[(1S)-1-[4-(1,3,5-triazin-2-yl)cyclohexa-1,5-dien-1-yl]ethyl]pyrrolidine-2-carboxamide.
| Compound Name | (2S)-1-[(2S)-2-[[(2Z)-2-hydrazinylidenepropylidene]amino]-3-methylbutanoyl]-N-[(1S)-1-[4-(1,3,5-triazin-2-yl)cyclohexa-1,5-dien-1-yl]ethyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 170954629 |
| Molecular Formula | C24H34N8O2 |
| Molecular Weight | 466.59 g/mol |
| Exact Mass | 466.28 |
| IUPAC Name | (2S)-1-[(2S)-2-[[(2Z)-2-hydrazinylidenepropylidene]amino]-3-methylbutanoyl]-N-[(1S)-1-[4-(1,3,5-triazin-2-yl)cyclohexa-1,5-dien-1-yl]ethyl]pyrrolidine-2-carboxamide |
| SMILES | CC(/C=N/[C@H](C(=O)N1CCC[C@H]1C(=O)N[C@@H](C)C1=CCC(c2ncncn2)C=C1)C(C)C)=N/N |
| InChI | InChI=1S/C24H34N8O2/c1-15(2)21(27-12-16(3)31-25)24(34)32-11-5-6-20(32)23(33)30-17(4)18-7-9-19(10-8-18)22-28-13-26-14-29-22/h7-9,12-15,17,19-21H,5-6,10-11,25H2,1-4H3,(H,30,33)/b27-12+,31-16-/t17-,19?,20-,21-/m0/s1 |
| InChIKey | YPSOIPNTSVEBIH-UYSGSCEOSA-N |
| XLogP | 1.77 |
| TPSA | 138.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.59 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|