C24H31N8O2+ — CID 170954750
[(2Z)-2-hydrazinylidenepropylidene]-[3-methyl-1-oxo-1-[(2S)-2-[[(1S)-1-[4-(1,3,5-triazin-2-yl)phenyl]ethyl]carbamoyl]pyrrolidin-1-yl]but-2-en-2-yl]azanium (PubChem CID 170954750) has the molecular formula C24H31N8O2+ and a molecular weight of 463.57 g/mol. Its IUPAC name is [(2Z)-2-hydrazinylidenepropylidene]-[3-methyl-1-oxo-1-[(2S)-2-[[(1S)-1-[4-(1,3,5-triazin-2-yl)phenyl]ethyl]carbamoyl]pyrrolidin-1-yl]but-2-en-2-yl]azanium.
| Compound Name | [(2Z)-2-hydrazinylidenepropylidene]-[3-methyl-1-oxo-1-[(2S)-2-[[(1S)-1-[4-(1,3,5-triazin-2-yl)phenyl]ethyl]carbamoyl]pyrrolidin-1-yl]but-2-en-2-yl]azanium |
|---|---|
| PubChem CID | 170954750 |
| Molecular Formula | C24H31N8O2+ |
| Molecular Weight | 463.57 g/mol |
| Exact Mass | 463.26 |
| IUPAC Name | [(2Z)-2-hydrazinylidenepropylidene]-[3-methyl-1-oxo-1-[(2S)-2-[[(1S)-1-[4-(1,3,5-triazin-2-yl)phenyl]ethyl]carbamoyl]pyrrolidin-1-yl]but-2-en-2-yl]azanium |
| SMILES | CC(C)=C(/[NH+]=C/C(C)=N\N)C(=O)N1CCC[C@H]1C(=O)N[C@@H](C)c1ccc(-c2ncncn2)cc1 |
| InChI | InChI=1S/C24H30N8O2/c1-15(2)21(27-12-16(3)31-25)24(34)32-11-5-6-20(32)23(33)30-17(4)18-7-9-19(10-8-18)22-28-13-26-14-29-22/h7-10,12-14,17,20H,5-6,11,25H2,1-4H3,(H,30,33)/p+1/b27-12+,31-16-/t17-,20-/m0/s1 |
| InChIKey | SZMUKVBFRCQWKC-MATHKGFXSA-O |
| XLogP | 0.49 |
| TPSA | 140.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.57 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|