C29H42N6O2 — CID 170955608
ethane;2-[[(2Z)-2-hydrazinylidenepropylidene]amino]-3-methyl-1-(2-methylpyrrolidin-1-yl)but-2-en-1-one;N-[1-(4-pyridin-4-ylphenyl)ethyl]formamide (PubChem CID 170955608) has the molecular formula C29H42N6O2 and a molecular weight of 506.70 g/mol. Its IUPAC name is ethane;2-[[(2Z)-2-hydrazinylidenepropylidene]amino]-3-methyl-1-(2-methylpyrrolidin-1-yl)but-2-en-1-one;N-[1-(4-pyridin-4-ylphenyl)ethyl]formamide.
| Compound Name | ethane;2-[[(2Z)-2-hydrazinylidenepropylidene]amino]-3-methyl-1-(2-methylpyrrolidin-1-yl)but-2-en-1-one;N-[1-(4-pyridin-4-ylphenyl)ethyl]formamide |
|---|---|
| PubChem CID | 170955608 |
| Molecular Formula | C29H42N6O2 |
| Molecular Weight | 506.70 g/mol |
| Exact Mass | 506.34 |
| IUPAC Name | ethane;2-[[(2Z)-2-hydrazinylidenepropylidene]amino]-3-methyl-1-(2-methylpyrrolidin-1-yl)but-2-en-1-one;N-[1-(4-pyridin-4-ylphenyl)ethyl]formamide |
| SMILES | CC.CC(C)=C(/N=C/C(C)=N\N)C(=O)N1CCCC1C.CC(NC=O)c1ccc(-c2ccncc2)cc1 |
| InChI | InChI=1S/C14H14N2O.C13H22N4O.C2H6/c1-11(16-10-17)12-2-4-13(5-3-12)14-6-8-15-9-7-14;1-9(2)12(15-8-10(3)16-14)13(18)17-7-5-6-11(17)4;1-2/h2-11H,1H3,(H,16,17);8,11H,5-7,14H2,1-4H3;1-2H3/b;15-8+,16-10-; |
| InChIKey | SGVZEWKDXBMAOZ-MJFAAGNCSA-N |
| XLogP | 5.28 |
| TPSA | 113.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.70 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|