About 2-cyclopropyl-N-(3,4-dihydro-2H-chromen-4-yl)-1H-benzimidazol-4-amine
2-cyclopropyl-N-(3,4-dihydro-2H-chromen-4-yl)-1H-benzimidazol-4-amine (PubChem CID 170958607) has the molecular formula C19H19N3O
and a molecular weight of 305.38 g/mol. Its IUPAC name is 2-cyclopropyl-N-(3,4-dihydro-2H-chromen-4-yl)-1H-benzimidazol-4-amine.
Molecular Properties
| Compound Name | 2-cyclopropyl-N-(3,4-dihydro-2H-chromen-4-yl)-1H-benzimidazol-4-amine |
| PubChem CID | 170958607 |
| Molecular Formula | C19H19N3O |
| Molecular Weight | 305.38 g/mol |
| Exact Mass | 305.15 |
| IUPAC Name | 2-cyclopropyl-N-(3,4-dihydro-2H-chromen-4-yl)-1H-benzimidazol-4-amine |
| SMILES | c1ccc2c(c1)OCCC2Nc1cccc2[nH]c(C3CC3)nc12 |
| InChI | InChI=1S/C19H19N3O/c1-2-7-17-13(4-1)14(10-11-23-17)20-15-5-3-6-16-18(15)22-19(21-16)12-8-9-12/h1-7,12,14,20H,8-11H2,(H,21,22) |
| InChIKey | QFIRGSIJHZHERW-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 49.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.38 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-cyclopropyl-N-(3,4-dihydro-2H-chromen-4-yl)-1H-benzimidazol-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclopropyl-N-(3,4-dihydro-2H-chromen-4-yl)-1H-benzimidazol-4-amine?
The IUPAC name of 2-cyclopropyl-N-(3,4-dihydro-2H-chromen-4-yl)-1H-benzimidazol-4-amine (CID 170958607) is 2-cyclopropyl-N-(3,4-dihydro-2H-chromen-4-yl)-1H-benzimidazol-4-amine.
What is the SMILES notation for 2-cyclopropyl-N-(3,4-dihydro-2H-chromen-4-yl)-1H-benzimidazol-4-amine?
The canonical SMILES for 2-cyclopropyl-N-(3,4-dihydro-2H-chromen-4-yl)-1H-benzimidazol-4-amine is c1ccc2c(c1)OCCC2Nc1cccc2[nH]c(C3CC3)nc12.
What is the InChIKey of 2-cyclopropyl-N-(3,4-dihydro-2H-chromen-4-yl)-1H-benzimidazol-4-amine?
The InChIKey is QFIRGSIJHZHERW-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H19N3O/c1-2-7-17-13(4-1)14(10-11-23-17)20-15-5-3-6-16-18(15)22-19(21-16)12-8-9-12/h1-7,12,14,20H,8-11H2,(H,21,22).
What are the key properties of 2-cyclopropyl-N-(3,4-dihydro-2H-chromen-4-yl)-1H-benzimidazol-4-amine?
2-cyclopropyl-N-(3,4-dihydro-2H-chromen-4-yl)-1H-benzimidazol-4-amine has a molecular weight of 305.38 g/mol, XLogP of 4.38, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclopropyl-N-(3,4-dihydro-2H-chromen-4-yl)-1H-benzimidazol-4-amine is sourced from PubChem (CID 170958607), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).