C17H20N5OP — CID 170960838
3-cyclopentyl-3-[4-(7-phosphanylpyrrolo[2,3-d]pyrimidin-4-yl)pyrazol-1-yl]propanal (PubChem CID 170960838) has the molecular formula C17H20N5OP and a molecular weight of 341.36 g/mol. Its IUPAC name is 3-cyclopentyl-3-[4-(7-phosphanylpyrrolo[2,3-d]pyrimidin-4-yl)pyrazol-1-yl]propanal.
| Compound Name | 3-cyclopentyl-3-[4-(7-phosphanylpyrrolo[2,3-d]pyrimidin-4-yl)pyrazol-1-yl]propanal |
|---|---|
| PubChem CID | 170960838 |
| Molecular Formula | C17H20N5OP |
| Molecular Weight | 341.36 g/mol |
| Exact Mass | 341.14 |
| IUPAC Name | 3-cyclopentyl-3-[4-(7-phosphanylpyrrolo[2,3-d]pyrimidin-4-yl)pyrazol-1-yl]propanal |
| SMILES | O=CCC(C1CCCC1)n1cc(-c2ncnc3c2ccn3P)cn1 |
| InChI | InChI=1S/C17H20N5OP/c23-8-6-15(12-3-1-2-4-12)21-10-13(9-20-21)16-14-5-7-22(24)17(14)19-11-18-16/h5,7-12,15H,1-4,6,24H2 |
| InChIKey | HBNVCOLJOGAWHT-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 65.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.36 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|