C21H25BClIN4O3S — CID 170961399
[4-[5-chloro-3-methyl-2-[(6-methylmorpholin-2-yl)methyl]phenyl]pyrrolo[2,1-f][1,2,4]triazin-6-yl]methyl-iodo-methoxysulfanyloxyborane (PubChem CID 170961399) has the molecular formula C21H25BClIN4O3S and a molecular weight of 586.69 g/mol. Its IUPAC name is [4-[5-chloro-3-methyl-2-[(6-methylmorpholin-2-yl)methyl]phenyl]pyrrolo[2,1-f][1,2,4]triazin-6-yl]methyl-iodo-methoxysulfanyloxyborane.
| Compound Name | [4-[5-chloro-3-methyl-2-[(6-methylmorpholin-2-yl)methyl]phenyl]pyrrolo[2,1-f][1,2,4]triazin-6-yl]methyl-iodo-methoxysulfanyloxyborane |
|---|---|
| PubChem CID | 170961399 |
| Molecular Formula | C21H25BClIN4O3S |
| Molecular Weight | 586.69 g/mol |
| Exact Mass | 586.05 |
| IUPAC Name | [4-[5-chloro-3-methyl-2-[(6-methylmorpholin-2-yl)methyl]phenyl]pyrrolo[2,1-f][1,2,4]triazin-6-yl]methyl-iodo-methoxysulfanyloxyborane |
| SMILES | COSOB(I)Cc1cc2c(-c3cc(Cl)cc(C)c3CC3CNCC(C)O3)ncnn2c1 |
| InChI | InChI=1S/C21H25BClIN4O3S/c1-13-4-16(23)6-19(18(13)7-17-10-25-9-14(2)30-17)21-20-5-15(8-22(24)31-32-29-3)11-28(20)27-12-26-21/h4-6,11-12,14,17,25H,7-10H2,1-3H3 |
| InChIKey | QEDHQQUHVJPFCB-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 69.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.69 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|