C24H24N8OS — CID 170962428
(5S)-N-[5-[2-(2,3-dihydro-1H-inden-2-ylamino)pyrimidin-5-yl]-4-methyl-1,3-thiazol-2-yl]-4,5,6,7-tetrahydro-2H-benzotriazole-5-carboxamide (PubChem CID 170962428) has the molecular formula C24H24N8OS and a molecular weight of 472.58 g/mol. Its IUPAC name is (5S)-N-[5-[2-(2,3-dihydro-1H-inden-2-ylamino)pyrimidin-5-yl]-4-methyl-1,3-thiazol-2-yl]-4,5,6,7-tetrahydro-2H-benzotriazole-5-carboxamide.
| Compound Name | (5S)-N-[5-[2-(2,3-dihydro-1H-inden-2-ylamino)pyrimidin-5-yl]-4-methyl-1,3-thiazol-2-yl]-4,5,6,7-tetrahydro-2H-benzotriazole-5-carboxamide |
|---|---|
| PubChem CID | 170962428 |
| Molecular Formula | C24H24N8OS |
| Molecular Weight | 472.58 g/mol |
| Exact Mass | 472.18 |
| IUPAC Name | (5S)-N-[5-[2-(2,3-dihydro-1H-inden-2-ylamino)pyrimidin-5-yl]-4-methyl-1,3-thiazol-2-yl]-4,5,6,7-tetrahydro-2H-benzotriazole-5-carboxamide |
| SMILES | Cc1nc(NC(=O)[C@H]2CCc3n[nH]nc3C2)sc1-c1cnc(NC2Cc3ccccc3C2)nc1 |
| InChI | InChI=1S/C24H24N8OS/c1-13-21(34-24(27-13)29-22(33)16-6-7-19-20(10-16)31-32-30-19)17-11-25-23(26-12-17)28-18-8-14-4-2-3-5-15(14)9-18/h2-5,11-12,16,18H,6-10H2,1H3,(H,25,26,28)(H,27,29,33)(H,30,31,32)/t16-/m0/s1 |
| InChIKey | VXLHYMVSHKRWIS-INIZCTEOSA-N |
| XLogP | 3.35 |
| TPSA | 121.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.58 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |