C29H31N7O2 — CID 170962441
(5S)-N-[3-[2-(2,3-dihydro-1H-inden-2-ylamino)pyrimidin-5-yl]-5-propan-2-yloxyphenyl]-4,5,6,7-tetrahydro-2H-benzotriazole-5-carboxamide (PubChem CID 170962441) has the molecular formula C29H31N7O2 and a molecular weight of 509.61 g/mol. Its IUPAC name is (5S)-N-[3-[2-(2,3-dihydro-1H-inden-2-ylamino)pyrimidin-5-yl]-5-propan-2-yloxyphenyl]-4,5,6,7-tetrahydro-2H-benzotriazole-5-carboxamide.
| Compound Name | (5S)-N-[3-[2-(2,3-dihydro-1H-inden-2-ylamino)pyrimidin-5-yl]-5-propan-2-yloxyphenyl]-4,5,6,7-tetrahydro-2H-benzotriazole-5-carboxamide |
|---|---|
| PubChem CID | 170962441 |
| Molecular Formula | C29H31N7O2 |
| Molecular Weight | 509.61 g/mol |
| Exact Mass | 509.25 |
| IUPAC Name | (5S)-N-[3-[2-(2,3-dihydro-1H-inden-2-ylamino)pyrimidin-5-yl]-5-propan-2-yloxyphenyl]-4,5,6,7-tetrahydro-2H-benzotriazole-5-carboxamide |
| SMILES | CC(C)Oc1cc(NC(=O)[C@H]2CCc3n[nH]nc3C2)cc(-c2cnc(NC3Cc4ccccc4C3)nc2)c1 |
| InChI | InChI=1S/C29H31N7O2/c1-17(2)38-25-12-21(11-24(14-25)32-28(37)20-7-8-26-27(13-20)35-36-34-26)22-15-30-29(31-16-22)33-23-9-18-5-3-4-6-19(18)10-23/h3-6,11-12,14-17,20,23H,7-10,13H2,1-2H3,(H,32,37)(H,30,31,33)(H,34,35,36)/t20-/m0/s1 |
| InChIKey | JRZWRLTWKXKDNU-FQEVSTJZSA-N |
| XLogP | 4.37 |
| TPSA | 117.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.61 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |