C26H25N7O3S — CID 174195043
4-amino-3-diazenyl-N-[3-[2-(2,3-dihydro-1H-inden-2-ylamino)pyrimidin-5-yl]-5-methoxyphenyl]benzenesulfonamide (PubChem CID 174195043) has the molecular formula C26H25N7O3S and a molecular weight of 515.60 g/mol. Its IUPAC name is 4-amino-3-diazenyl-N-[3-[2-(2,3-dihydro-1H-inden-2-ylamino)pyrimidin-5-yl]-5-methoxyphenyl]benzenesulfonamide.
| Compound Name | 4-amino-3-diazenyl-N-[3-[2-(2,3-dihydro-1H-inden-2-ylamino)pyrimidin-5-yl]-5-methoxyphenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 174195043 |
| Molecular Formula | C26H25N7O3S |
| Molecular Weight | 515.60 g/mol |
| Exact Mass | 515.17 |
| IUPAC Name | 4-amino-3-diazenyl-N-[3-[2-(2,3-dihydro-1H-inden-2-ylamino)pyrimidin-5-yl]-5-methoxyphenyl]benzenesulfonamide |
| SMILES | [H]/N=N/c1cc(S(=O)(=O)Nc2cc(OC)cc(-c3cnc(NC4Cc5ccccc5C4)nc3)c2)ccc1N |
| InChI | InChI=1S/C26H25N7O3S/c1-36-22-11-18(10-21(12-22)33-37(34,35)23-6-7-24(27)25(13-23)32-28)19-14-29-26(30-15-19)31-20-8-16-4-2-3-5-17(16)9-20/h2-7,10-15,20,28,33H,8-9,27H2,1H3,(H,29,30,31)/b32-28+ |
| InChIKey | DTGMUJUUXOIXDA-VEWQFJOQSA-N |
| XLogP | 4.78 |
| TPSA | 155.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.60 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|