C28H29N7O — CID 170962370
(5S)-N-[(1S)-1-[4-[2-(2,3-dihydro-1H-inden-2-ylamino)pyrimidin-5-yl]phenyl]ethyl]-4,5,6,7-tetrahydro-2H-benzotriazole-5-carboxamide (PubChem CID 170962370) has the molecular formula C28H29N7O and a molecular weight of 479.59 g/mol. Its IUPAC name is (5S)-N-[(1S)-1-[4-[2-(2,3-dihydro-1H-inden-2-ylamino)pyrimidin-5-yl]phenyl]ethyl]-4,5,6,7-tetrahydro-2H-benzotriazole-5-carboxamide.
| Compound Name | (5S)-N-[(1S)-1-[4-[2-(2,3-dihydro-1H-inden-2-ylamino)pyrimidin-5-yl]phenyl]ethyl]-4,5,6,7-tetrahydro-2H-benzotriazole-5-carboxamide |
|---|---|
| PubChem CID | 170962370 |
| Molecular Formula | C28H29N7O |
| Molecular Weight | 479.59 g/mol |
| Exact Mass | 479.24 |
| IUPAC Name | (5S)-N-[(1S)-1-[4-[2-(2,3-dihydro-1H-inden-2-ylamino)pyrimidin-5-yl]phenyl]ethyl]-4,5,6,7-tetrahydro-2H-benzotriazole-5-carboxamide |
| SMILES | C[C@H](NC(=O)[C@H]1CCc2n[nH]nc2C1)c1ccc(-c2cnc(NC3Cc4ccccc4C3)nc2)cc1 |
| InChI | InChI=1S/C28H29N7O/c1-17(31-27(36)22-10-11-25-26(14-22)34-35-33-25)18-6-8-19(9-7-18)23-15-29-28(30-16-23)32-24-12-20-4-2-3-5-21(20)13-24/h2-9,15-17,22,24H,10-14H2,1H3,(H,31,36)(H,29,30,32)(H,33,34,35)/t17-,22-/m0/s1 |
| InChIKey | ZIKJYXAVGUNCGP-JTSKRJEESA-N |
| XLogP | 3.82 |
| TPSA | 108.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.59 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |