C32H34N4O3 — CID 170963355
tert-butyl N-[(3R)-2-oxo-1-[(1-tritylimidazol-4-yl)methyl]pyrrolidin-3-yl]carbamate (PubChem CID 170963355) has the molecular formula C32H34N4O3 and a molecular weight of 522.65 g/mol. Its IUPAC name is tert-butyl N-[(3R)-2-oxo-1-[(1-tritylimidazol-4-yl)methyl]pyrrolidin-3-yl]carbamate.
| Compound Name | tert-butyl N-[(3R)-2-oxo-1-[(1-tritylimidazol-4-yl)methyl]pyrrolidin-3-yl]carbamate |
|---|---|
| PubChem CID | 170963355 |
| Molecular Formula | C32H34N4O3 |
| Molecular Weight | 522.65 g/mol |
| Exact Mass | 522.26 |
| IUPAC Name | tert-butyl N-[(3R)-2-oxo-1-[(1-tritylimidazol-4-yl)methyl]pyrrolidin-3-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@H]1CCN(Cc2cn(C(c3ccccc3)(c3ccccc3)c3ccccc3)cn2)C1=O |
| InChI | InChI=1S/C32H34N4O3/c1-31(2,3)39-30(38)34-28-19-20-35(29(28)37)21-27-22-36(23-33-27)32(24-13-7-4-8-14-24,25-15-9-5-10-16-25)26-17-11-6-12-18-26/h4-18,22-23,28H,19-21H2,1-3H3,(H,34,38)/t28-/m1/s1 |
| InChIKey | PVRSRNIHBAIDPQ-MUUNZHRXSA-N |
| XLogP | 5.35 |
| TPSA | 76.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.65 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|