C42H45N5O4 — CID 11607197
methyl (2S)-2-[[(2S)-2-benzyl-3-oxo-4-[(1-tritylimidazol-4-yl)methyl]piperazine-1-carbonyl]amino]-4-methylpentanoate (PubChem CID 11607197) has the molecular formula C42H45N5O4 and a molecular weight of 683.85 g/mol. Its IUPAC name is methyl (2S)-2-[[(2S)-2-benzyl-3-oxo-4-[(1-tritylimidazol-4-yl)methyl]piperazine-1-carbonyl]amino]-4-methylpentanoate.
| Compound Name | methyl (2S)-2-[[(2S)-2-benzyl-3-oxo-4-[(1-tritylimidazol-4-yl)methyl]piperazine-1-carbonyl]amino]-4-methylpentanoate |
|---|---|
| PubChem CID | 11607197 |
| Molecular Formula | C42H45N5O4 |
| Molecular Weight | 683.85 g/mol |
| Exact Mass | 683.35 |
| IUPAC Name | methyl (2S)-2-[[(2S)-2-benzyl-3-oxo-4-[(1-tritylimidazol-4-yl)methyl]piperazine-1-carbonyl]amino]-4-methylpentanoate |
| SMILES | COC(=O)[C@H](CC(C)C)NC(=O)N1CCN(Cc2cn(C(c3ccccc3)(c3ccccc3)c3ccccc3)cn2)C(=O)[C@@H]1Cc1ccccc1 |
| InChI | InChI=1S/C42H45N5O4/c1-31(2)26-37(40(49)51-3)44-41(50)47-25-24-45(39(48)38(47)27-32-16-8-4-9-17-32)28-36-29-46(30-43-36)42(33-18-10-5-11-19-33,34-20-12-6-13-21-34)35-22-14-7-15-23-35/h4-23,29-31,37-38H,24-28H2,1-3H3,(H,44,50)/t37-,38-/m0/s1 |
| InChIKey | DRCQTLUPHXVLPG-UWXQCODUSA-N |
| XLogP | 6.28 |
| TPSA | 96.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 683.85 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|