C20H24ClN3O4 — CID 54569475
tert-butyl N-[(3S)-1-[(1-chloro-6-methoxyisoquinolin-7-yl)methyl]-2-oxopyrrolidin-3-yl]carbamate (PubChem CID 54569475) has the molecular formula C20H24ClN3O4 and a molecular weight of 405.88 g/mol. Its IUPAC name is tert-butyl N-[(3S)-1-[(1-chloro-6-methoxyisoquinolin-7-yl)methyl]-2-oxopyrrolidin-3-yl]carbamate.
| Compound Name | tert-butyl N-[(3S)-1-[(1-chloro-6-methoxyisoquinolin-7-yl)methyl]-2-oxopyrrolidin-3-yl]carbamate |
|---|---|
| PubChem CID | 54569475 |
| Molecular Formula | C20H24ClN3O4 |
| Molecular Weight | 405.88 g/mol |
| Exact Mass | 405.15 |
| IUPAC Name | tert-butyl N-[(3S)-1-[(1-chloro-6-methoxyisoquinolin-7-yl)methyl]-2-oxopyrrolidin-3-yl]carbamate |
| SMILES | COc1cc2ccnc(Cl)c2cc1CN1CC[C@H](NC(=O)OC(C)(C)C)C1=O |
| InChI | InChI=1S/C20H24ClN3O4/c1-20(2,3)28-19(26)23-15-6-8-24(18(15)25)11-13-9-14-12(10-16(13)27-4)5-7-22-17(14)21/h5,7,9-10,15H,6,8,11H2,1-4H3,(H,23,26)/t15-/m0/s1 |
| InChIKey | ZWFHYRSGEGPXMO-HNNXBMFYSA-N |
| XLogP | 3.52 |
| TPSA | 80.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.88 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|