C26H36 — CID 170966815
1-(2,2-dimethylpent-3-ynyl)-4-[2-(4-methylphenyl)propan-2-yl]benzene;propane (PubChem CID 170966815) has the molecular formula C26H36 and a molecular weight of 348.57 g/mol. Its IUPAC name is 1-(2,2-dimethylpent-3-ynyl)-4-[2-(4-methylphenyl)propan-2-yl]benzene;propane.
| Compound Name | 1-(2,2-dimethylpent-3-ynyl)-4-[2-(4-methylphenyl)propan-2-yl]benzene;propane |
|---|---|
| PubChem CID | 170966815 |
| Molecular Formula | C26H36 |
| Molecular Weight | 348.57 g/mol |
| Exact Mass | 348.28 |
| IUPAC Name | 1-(2,2-dimethylpent-3-ynyl)-4-[2-(4-methylphenyl)propan-2-yl]benzene;propane |
| SMILES | CC#CC(C)(C)Cc1ccc(C(C)(C)c2ccc(C)cc2)cc1.CCC |
| InChI | InChI=1S/C23H28.C3H8/c1-7-16-22(3,4)17-19-10-14-21(15-11-19)23(5,6)20-12-8-18(2)9-13-20;1-3-2/h8-15H,17H2,1-6H3;3H2,1-2H3 |
| InChIKey | IXMNTVWUKQNVDU-UHFFFAOYSA-N |
| XLogP | 7.33 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.57 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|