C18H17F2IN4OS — CID 170968183
N-[4-[(E)-1-aminoprop-1-en-2-yl]-[1,3]thiazolo[5,4-f]isoquinolin-8-yl]-2,2-difluorocyclopropane-1-carboxamide;iodomethane (PubChem CID 170968183) has the molecular formula C18H17F2IN4OS and a molecular weight of 502.33 g/mol. Its IUPAC name is N-[4-[(E)-1-aminoprop-1-en-2-yl]-[1,3]thiazolo[5,4-f]isoquinolin-8-yl]-2,2-difluorocyclopropane-1-carboxamide;iodomethane.
| Compound Name | N-[4-[(E)-1-aminoprop-1-en-2-yl]-[1,3]thiazolo[5,4-f]isoquinolin-8-yl]-2,2-difluorocyclopropane-1-carboxamide;iodomethane |
|---|---|
| PubChem CID | 170968183 |
| Molecular Formula | C18H17F2IN4OS |
| Molecular Weight | 502.33 g/mol |
| Exact Mass | 502.01 |
| IUPAC Name | N-[4-[(E)-1-aminoprop-1-en-2-yl]-[1,3]thiazolo[5,4-f]isoquinolin-8-yl]-2,2-difluorocyclopropane-1-carboxamide;iodomethane |
| SMILES | C/C(=C\N)c1cc2cnc(NC(=O)C3CC3(F)F)cc2c2scnc12.CI |
| InChI | InChI=1S/C17H14F2N4OS.CH3I/c1-8(5-20)10-2-9-6-21-13(23-16(24)12-4-17(12,18)19)3-11(9)15-14(10)22-7-25-15;1-2/h2-3,5-7,12H,4,20H2,1H3,(H,21,23,24);1H3/b8-5+; |
| InChIKey | RLXKYHBNWZJIIT-HAAWTFQLSA-N |
| XLogP | 4.81 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.33 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|