C29H43BrN4O7SSi — CID 170970194
methyl (2S)-2-[[(2S)-2-[[2-[4-(6-bromohexanoylamino)phenyl]-1,3-thiazole-4-carbonyl]amino]-3-[tert-butyl(dimethyl)silyl]oxypropanoyl]amino]-3-hydroxypropanoate (PubChem CID 170970194) has the molecular formula C29H43BrN4O7SSi and a molecular weight of 699.74 g/mol. Its IUPAC name is methyl (2S)-2-[[(2S)-2-[[2-[4-(6-bromohexanoylamino)phenyl]-1,3-thiazole-4-carbonyl]amino]-3-[tert-butyl(dimethyl)silyl]oxypropanoyl]amino]-3-hydroxypropanoate.
| Compound Name | methyl (2S)-2-[[(2S)-2-[[2-[4-(6-bromohexanoylamino)phenyl]-1,3-thiazole-4-carbonyl]amino]-3-[tert-butyl(dimethyl)silyl]oxypropanoyl]amino]-3-hydroxypropanoate |
|---|---|
| PubChem CID | 170970194 |
| Molecular Formula | C29H43BrN4O7SSi |
| Molecular Weight | 699.74 g/mol |
| Exact Mass | 698.18 |
| IUPAC Name | methyl (2S)-2-[[(2S)-2-[[2-[4-(6-bromohexanoylamino)phenyl]-1,3-thiazole-4-carbonyl]amino]-3-[tert-butyl(dimethyl)silyl]oxypropanoyl]amino]-3-hydroxypropanoate |
| SMILES | COC(=O)[C@H](CO)NC(=O)[C@H](CO[Si](C)(C)C(C)(C)C)NC(=O)c1csc(-c2ccc(NC(=O)CCCCCBr)cc2)n1 |
| InChI | InChI=1S/C29H43BrN4O7SSi/c1-29(2,3)43(5,6)41-17-22(25(37)32-21(16-35)28(39)40-4)33-26(38)23-18-42-27(34-23)19-11-13-20(14-12-19)31-24(36)10-8-7-9-15-30/h11-14,18,21-22,35H,7-10,15-17H2,1-6H3,(H,31,36)(H,32,37)(H,33,38)/t21-,22-/m0/s1 |
| InChIKey | FXMRYRIYHJPPQZ-VXKWHMMOSA-N |
| XLogP | 4.47 |
| TPSA | 155.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 699.74 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|