C26H38N6O5SSi — CID 170970254
methyl (2S)-2-[[2-[4-(6-azidohexanoylamino)phenyl]-1,3-thiazole-4-carbonyl]amino]-3-[tert-butyl(dimethyl)silyl]oxypropanoate (PubChem CID 170970254) has the molecular formula C26H38N6O5SSi and a molecular weight of 574.78 g/mol. Its IUPAC name is methyl (2S)-2-[[2-[4-(6-azidohexanoylamino)phenyl]-1,3-thiazole-4-carbonyl]amino]-3-[tert-butyl(dimethyl)silyl]oxypropanoate.
| Compound Name | methyl (2S)-2-[[2-[4-(6-azidohexanoylamino)phenyl]-1,3-thiazole-4-carbonyl]amino]-3-[tert-butyl(dimethyl)silyl]oxypropanoate |
|---|---|
| PubChem CID | 170970254 |
| Molecular Formula | C26H38N6O5SSi |
| Molecular Weight | 574.78 g/mol |
| Exact Mass | 574.24 |
| IUPAC Name | methyl (2S)-2-[[2-[4-(6-azidohexanoylamino)phenyl]-1,3-thiazole-4-carbonyl]amino]-3-[tert-butyl(dimethyl)silyl]oxypropanoate |
| SMILES | COC(=O)[C@H](CO[Si](C)(C)C(C)(C)C)NC(=O)c1csc(-c2ccc(NC(=O)CCCCCN=[N+]=[N-])cc2)n1 |
| InChI | InChI=1S/C26H38N6O5SSi/c1-26(2,3)39(5,6)37-16-20(25(35)36-4)30-23(34)21-17-38-24(31-21)18-11-13-19(14-12-18)29-22(33)10-8-7-9-15-28-32-27/h11-14,17,20H,7-10,15-16H2,1-6H3,(H,29,33)(H,30,34)/t20-/m0/s1 |
| InChIKey | NCEPLGAHFHWQAP-FQEVSTJZSA-N |
| XLogP | 5.91 |
| TPSA | 155.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.78 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|