C35H47N3O6S — CID 170970377
tert-butyl 5-[4-[[4-[[3-oxo-3-[(3-oxo-3-phenylmethoxyprop-1-en-2-yl)amino]prop-1-en-2-yl]carbamoyl]-1,3-thiazol-2-yl]methyl]cyclooctyl]pentanoate (PubChem CID 170970377) has the molecular formula C35H47N3O6S and a molecular weight of 637.84 g/mol. Its IUPAC name is tert-butyl 5-[4-[[4-[[3-oxo-3-[(3-oxo-3-phenylmethoxyprop-1-en-2-yl)amino]prop-1-en-2-yl]carbamoyl]-1,3-thiazol-2-yl]methyl]cyclooctyl]pentanoate.
| Compound Name | tert-butyl 5-[4-[[4-[[3-oxo-3-[(3-oxo-3-phenylmethoxyprop-1-en-2-yl)amino]prop-1-en-2-yl]carbamoyl]-1,3-thiazol-2-yl]methyl]cyclooctyl]pentanoate |
|---|---|
| PubChem CID | 170970377 |
| Molecular Formula | C35H47N3O6S |
| Molecular Weight | 637.84 g/mol |
| Exact Mass | 637.32 |
| IUPAC Name | tert-butyl 5-[4-[[4-[[3-oxo-3-[(3-oxo-3-phenylmethoxyprop-1-en-2-yl)amino]prop-1-en-2-yl]carbamoyl]-1,3-thiazol-2-yl]methyl]cyclooctyl]pentanoate |
| SMILES | C=C(NC(=O)c1csc(CC2CCCCC(CCCCC(=O)OC(C)(C)C)CC2)n1)C(=O)NC(=C)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C35H47N3O6S/c1-24(32(40)37-25(2)34(42)43-22-28-16-7-6-8-17-28)36-33(41)29-23-45-30(38-29)21-27-15-10-9-13-26(19-20-27)14-11-12-18-31(39)44-35(3,4)5/h6-8,16-17,23,26-27H,1-2,9-15,18-22H2,3-5H3,(H,36,41)(H,37,40) |
| InChIKey | CZARNPPVROACBK-UHFFFAOYSA-N |
| XLogP | 6.79 |
| TPSA | 123.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.84 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|