C28H41N3O5S — CID 170970046
methyl 2-[2-[[2-[[5-(6-methylheptanoyl)cyclooctyl]methyl]-1,3-thiazole-4-carbonyl]amino]prop-2-enoylamino]prop-2-enoate (PubChem CID 170970046) has the molecular formula C28H41N3O5S and a molecular weight of 531.72 g/mol. Its IUPAC name is methyl 2-[2-[[2-[[5-(6-methylheptanoyl)cyclooctyl]methyl]-1,3-thiazole-4-carbonyl]amino]prop-2-enoylamino]prop-2-enoate.
| Compound Name | methyl 2-[2-[[2-[[5-(6-methylheptanoyl)cyclooctyl]methyl]-1,3-thiazole-4-carbonyl]amino]prop-2-enoylamino]prop-2-enoate |
|---|---|
| PubChem CID | 170970046 |
| Molecular Formula | C28H41N3O5S |
| Molecular Weight | 531.72 g/mol |
| Exact Mass | 531.28 |
| IUPAC Name | methyl 2-[2-[[2-[[5-(6-methylheptanoyl)cyclooctyl]methyl]-1,3-thiazole-4-carbonyl]amino]prop-2-enoylamino]prop-2-enoate |
| SMILES | C=C(NC(=O)c1csc(CC2CCCC(C(=O)CCCCC(C)C)CCC2)n1)C(=O)NC(=C)C(=O)OC |
| InChI | InChI=1S/C28H41N3O5S/c1-18(2)10-6-7-15-24(32)22-13-8-11-21(12-9-14-22)16-25-31-23(17-37-25)27(34)29-19(3)26(33)30-20(4)28(35)36-5/h17-18,21-22H,3-4,6-16H2,1-2,5H3,(H,29,34)(H,30,33) |
| InChIKey | BCRFAZKRHKJZLW-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 114.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.72 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|