C26H42N4O6S2 — CID 170970282
methyl 2-[2-[(2-propyl-1,3-thiazole-4-carbonyl)amino]prop-2-enoylamino]prop-2-enoate;2-propylpentyl N-(3-sulfanylpropyl)carbamate (PubChem CID 170970282) has the molecular formula C26H42N4O6S2 and a molecular weight of 570.78 g/mol. Its IUPAC name is methyl 2-[2-[(2-propyl-1,3-thiazole-4-carbonyl)amino]prop-2-enoylamino]prop-2-enoate;2-propylpentyl N-(3-sulfanylpropyl)carbamate.
| Compound Name | methyl 2-[2-[(2-propyl-1,3-thiazole-4-carbonyl)amino]prop-2-enoylamino]prop-2-enoate;2-propylpentyl N-(3-sulfanylpropyl)carbamate |
|---|---|
| PubChem CID | 170970282 |
| Molecular Formula | C26H42N4O6S2 |
| Molecular Weight | 570.78 g/mol |
| Exact Mass | 570.25 |
| IUPAC Name | methyl 2-[2-[(2-propyl-1,3-thiazole-4-carbonyl)amino]prop-2-enoylamino]prop-2-enoate;2-propylpentyl N-(3-sulfanylpropyl)carbamate |
| SMILES | C=C(NC(=O)c1csc(CCC)n1)C(=O)NC(=C)C(=O)OC.CCCC(CCC)COC(=O)NCCCS |
| InChI | InChI=1S/C14H17N3O4S.C12H25NO2S/c1-5-6-11-17-10(7-22-11)13(19)15-8(2)12(18)16-9(3)14(20)21-4;1-3-6-11(7-4-2)10-15-12(14)13-8-5-9-16/h7H,2-3,5-6H2,1,4H3,(H,15,19)(H,16,18);11,16H,3-10H2,1-2H3,(H,13,14) |
| InChIKey | QUAWGGLZMMGYRY-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 135.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.78 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|