About 2-propylpentyl N-(3-sulfanylpropyl)carbamate
2-propylpentyl N-(3-sulfanylpropyl)carbamate (PubChem CID 170970283) has the molecular formula C12H25NO2S
and a molecular weight of 247.40 g/mol. Its IUPAC name is 2-propylpentyl N-(3-sulfanylpropyl)carbamate.
Molecular Properties
| Compound Name | 2-propylpentyl N-(3-sulfanylpropyl)carbamate |
| PubChem CID | 170970283 |
| Molecular Formula | C12H25NO2S |
| Molecular Weight | 247.40 g/mol |
| Exact Mass | 247.16 |
| IUPAC Name | 2-propylpentyl N-(3-sulfanylpropyl)carbamate |
| SMILES | CCCC(CCC)COC(=O)NCCCS |
| InChI | InChI=1S/C12H25NO2S/c1-3-6-11(7-4-2)10-15-12(14)13-8-5-9-16/h11,16H,3-10H2,1-2H3,(H,13,14) |
| InChIKey | GCERXFORNJNHAS-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.40 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 2-propylpentyl N-(3-sulfanylpropyl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-propylpentyl N-(3-sulfanylpropyl)carbamate?
The IUPAC name of 2-propylpentyl N-(3-sulfanylpropyl)carbamate (CID 170970283) is 2-propylpentyl N-(3-sulfanylpropyl)carbamate.
What is the SMILES notation for 2-propylpentyl N-(3-sulfanylpropyl)carbamate?
The canonical SMILES for 2-propylpentyl N-(3-sulfanylpropyl)carbamate is CCCC(CCC)COC(=O)NCCCS.
What is the InChIKey of 2-propylpentyl N-(3-sulfanylpropyl)carbamate?
The InChIKey is GCERXFORNJNHAS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H25NO2S/c1-3-6-11(7-4-2)10-15-12(14)13-8-5-9-16/h11,16H,3-10H2,1-2H3,(H,13,14).
What are the key properties of 2-propylpentyl N-(3-sulfanylpropyl)carbamate?
2-propylpentyl N-(3-sulfanylpropyl)carbamate has a molecular weight of 247.40 g/mol, XLogP of 3.25, 9 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-propylpentyl N-(3-sulfanylpropyl)carbamate is sourced from PubChem (CID 170970283), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).