C19H14Cl3FN2O3 — CID 170974151
(2,4,6-trichlorophenyl) 7-fluoro-2-(oxan-2-yl)indazole-4-carboxylate (PubChem CID 170974151) has the molecular formula C19H14Cl3FN2O3 and a molecular weight of 443.69 g/mol. Its IUPAC name is (2,4,6-trichlorophenyl) 7-fluoro-2-(oxan-2-yl)indazole-4-carboxylate.
| Compound Name | (2,4,6-trichlorophenyl) 7-fluoro-2-(oxan-2-yl)indazole-4-carboxylate |
|---|---|
| PubChem CID | 170974151 |
| Molecular Formula | C19H14Cl3FN2O3 |
| Molecular Weight | 443.69 g/mol |
| Exact Mass | 442.01 |
| IUPAC Name | (2,4,6-trichlorophenyl) 7-fluoro-2-(oxan-2-yl)indazole-4-carboxylate |
| SMILES | O=C(Oc1c(Cl)cc(Cl)cc1Cl)c1ccc(F)c2nn(C3CCCCO3)cc12 |
| InChI | InChI=1S/C19H14Cl3FN2O3/c20-10-7-13(21)18(14(22)8-10)28-19(26)11-4-5-15(23)17-12(11)9-25(24-17)16-3-1-2-6-27-16/h4-5,7-9,16H,1-3,6H2 |
| InChIKey | ZLSKYDNNNRRRIY-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.69 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|