C15H14N2 — CID 170974550
3-methyl-7-(4-methylphenyl)pyrazolo[1,5-a]pyridine (PubChem CID 170974550) has the molecular formula C15H14N2 and a molecular weight of 222.29 g/mol. Its IUPAC name is 3-methyl-7-(4-methylphenyl)pyrazolo[1,5-a]pyridine.
| Compound Name | 3-methyl-7-(4-methylphenyl)pyrazolo[1,5-a]pyridine |
|---|---|
| PubChem CID | 170974550 |
| Molecular Formula | C15H14N2 |
| Molecular Weight | 222.29 g/mol |
| Exact Mass | 222.12 |
| IUPAC Name | 3-methyl-7-(4-methylphenyl)pyrazolo[1,5-a]pyridine |
| SMILES | Cc1ccc(-c2cccc3c(C)cnn23)cc1 |
| InChI | InChI=1S/C15H14N2/c1-11-6-8-13(9-7-11)15-5-3-4-14-12(2)10-16-17(14)15/h3-10H,1-2H3 |
| InChIKey | GPIKQHQMMZAOEV-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.29 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |