C23H22N2OS — CID 170976861
3,4-dihydro-2H-quinolin-1-yl-[3-(N-methylanilino)sulfanylphenyl]methanone (PubChem CID 170976861) has the molecular formula C23H22N2OS and a molecular weight of 374.51 g/mol. Its IUPAC name is 3,4-dihydro-2H-quinolin-1-yl-[3-(N-methylanilino)sulfanylphenyl]methanone.
| Compound Name | 3,4-dihydro-2H-quinolin-1-yl-[3-(N-methylanilino)sulfanylphenyl]methanone |
|---|---|
| PubChem CID | 170976861 |
| Molecular Formula | C23H22N2OS |
| Molecular Weight | 374.51 g/mol |
| Exact Mass | 374.15 |
| IUPAC Name | 3,4-dihydro-2H-quinolin-1-yl-[3-(N-methylanilino)sulfanylphenyl]methanone |
| SMILES | CN(Sc1cccc(C(=O)N2CCCc3ccccc32)c1)c1ccccc1 |
| InChI | InChI=1S/C23H22N2OS/c1-24(20-12-3-2-4-13-20)27-21-14-7-10-19(17-21)23(26)25-16-8-11-18-9-5-6-15-22(18)25/h2-7,9-10,12-15,17H,8,11,16H2,1H3 |
| InChIKey | BAQBLJAUWNIASI-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.51 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|