C12H11BrN2O3S — CID 170981660
methyl 5-bromo-3-ethyl-2-oxo-4-sulfanylidene-1H-quinazoline-7-carboxylate (PubChem CID 170981660) has the molecular formula C12H11BrN2O3S and a molecular weight of 343.20 g/mol. Its IUPAC name is methyl 5-bromo-3-ethyl-2-oxo-4-sulfanylidene-1H-quinazoline-7-carboxylate.
| Compound Name | methyl 5-bromo-3-ethyl-2-oxo-4-sulfanylidene-1H-quinazoline-7-carboxylate |
|---|---|
| PubChem CID | 170981660 |
| Molecular Formula | C12H11BrN2O3S |
| Molecular Weight | 343.20 g/mol |
| Exact Mass | 341.97 |
| IUPAC Name | methyl 5-bromo-3-ethyl-2-oxo-4-sulfanylidene-1H-quinazoline-7-carboxylate |
| SMILES | CCn1c(=O)[nH]c2cc(C(=O)OC)cc(Br)c2c1=S |
| InChI | InChI=1S/C12H11BrN2O3S/c1-3-15-10(19)9-7(13)4-6(11(16)18-2)5-8(9)14-12(15)17/h4-5H,3H2,1-2H3,(H,14,17) |
| InChIKey | XJHVWJPTSHIIBO-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 64.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.20 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|