C10H3Cl2FN2S — CID 170982379
2,4-dichloro-8-fluoro-[1]benzothiolo[3,2-d]pyrimidine (PubChem CID 170982379) has the molecular formula C10H3Cl2FN2S and a molecular weight of 273.12 g/mol. Its IUPAC name is 2,4-dichloro-8-fluoro-[1]benzothiolo[3,2-d]pyrimidine.
| Compound Name | 2,4-dichloro-8-fluoro-[1]benzothiolo[3,2-d]pyrimidine |
|---|---|
| PubChem CID | 170982379 |
| Molecular Formula | C10H3Cl2FN2S |
| Molecular Weight | 273.12 g/mol |
| Exact Mass | 271.94 |
| IUPAC Name | 2,4-dichloro-8-fluoro-[1]benzothiolo[3,2-d]pyrimidine |
| SMILES | Fc1ccc2sc3c(Cl)nc(Cl)nc3c2c1 |
| InChI | InChI=1S/C10H3Cl2FN2S/c11-9-8-7(14-10(12)15-9)5-3-4(13)1-2-6(5)16-8/h1-3H |
| InChIKey | BJIRJZNUMRYOCA-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.12 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |